C18H19FN4OS — CID 156845232
3-fluoro-N-(2-methylindazol-6-yl)-5-piperidin-4-ylthiophene-2-carboxamide (PubChem CID 156845232) has the molecular formula C18H19FN4OS and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-fluoro-N-(2-methylindazol-6-yl)-5-piperidin-4-ylthiophene-2-carboxamide.
| Compound Name | 3-fluoro-N-(2-methylindazol-6-yl)-5-piperidin-4-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 156845232 |
| Molecular Formula | C18H19FN4OS |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 3-fluoro-N-(2-methylindazol-6-yl)-5-piperidin-4-ylthiophene-2-carboxamide |
| SMILES | Cn1cc2ccc(NC(=O)c3sc(C4CCNCC4)cc3F)cc2n1 |
| InChI | InChI=1S/C18H19FN4OS/c1-23-10-12-2-3-13(8-15(12)22-23)21-18(24)17-14(19)9-16(25-17)11-4-6-20-7-5-11/h2-3,8-11,20H,4-7H2,1H3,(H,21,24) |
| InChIKey | LEOYJLFEORCERD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |