About 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine
6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine (PubChem CID 15684552) has the molecular formula C17H16N4O
and a molecular weight of 292.34 g/mol. Its IUPAC name is 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine |
| PubChem CID | 15684552 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine |
| SMILES | Cc1ccn2cc(CCc3ccc4nc(N)oc4c3)nc2c1 |
| InChI | InChI=1S/C17H16N4O/c1-11-6-7-21-10-13(19-16(21)8-11)4-2-12-3-5-14-15(9-12)22-17(18)20-14/h3,5-10H,2,4H2,1H3,(H2,18,20) |
| InChIKey | PXGAEPWKKBKAEJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine?
The IUPAC name of 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine (CID 15684552) is 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine.
What is the SMILES notation for 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine?
The canonical SMILES for 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine is Cc1ccn2cc(CCc3ccc4nc(N)oc4c3)nc2c1.
What is the InChIKey of 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine?
The InChIKey is PXGAEPWKKBKAEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O/c1-11-6-7-21-10-13(19-16(21)8-11)4-2-12-3-5-14-15(9-12)22-17(18)20-14/h3,5-10H,2,4H2,1H3,(H2,18,20).
What are the key properties of 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine?
6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine has a molecular weight of 292.34 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(7-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1,3-benzoxazol-2-amine is sourced from PubChem (CID 15684552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).