C21H26N4O2 — CID 15684661
1-[4-[2-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)ethyl]-2-hydroxyphenyl]-3-propan-2-ylurea (PubChem CID 15684661) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-[4-[2-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)ethyl]-2-hydroxyphenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[2-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)ethyl]-2-hydroxyphenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 15684661 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-[4-[2-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)ethyl]-2-hydroxyphenyl]-3-propan-2-ylurea |
| SMILES | Cc1ccn2c(C)c(CCc3ccc(NC(=O)NC(C)C)c(O)c3)nc2c1 |
| InChI | InChI=1S/C21H26N4O2/c1-13(2)22-21(27)24-18-8-6-16(12-19(18)26)5-7-17-15(4)25-10-9-14(3)11-20(25)23-17/h6,8-13,26H,5,7H2,1-4H3,(H2,22,24,27) |
| InChIKey | QTCRPTXEYLENMQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|