About ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole
ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole (PubChem CID 156847025) has the molecular formula C9H15F3N2O
and a molecular weight of 224.23 g/mol. Its IUPAC name is ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole.
Molecular Properties
| Compound Name | ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole |
| PubChem CID | 156847025 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole |
| SMILES | CC.COCc1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C7H9F3N2O.C2H6/c1-13-4-6-2-3-12(11-6)5-7(8,9)10;1-2/h2-3H,4-5H2,1H3;1-2H3 |
| InChIKey | FQUXYISIZAGGFB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole?
The IUPAC name of ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole (CID 156847025) is ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole.
What is the SMILES notation for ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole?
The canonical SMILES for ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole is CC.COCc1ccn(CC(F)(F)F)n1.
What is the InChIKey of ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole?
The InChIKey is FQUXYISIZAGGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2O.C2H6/c1-13-4-6-2-3-12(11-6)5-7(8,9)10;1-2/h2-3H,4-5H2,1H3;1-2H3.
What are the key properties of ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole?
ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole has a molecular weight of 224.23 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(methoxymethyl)-1-(2,2,2-trifluoroethyl)pyrazole is sourced from PubChem (CID 156847025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).