C9H8F3N5 — CID 156847163
(8S)-8-methyl-5-(trifluoromethyl)-3,4,6,9,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 156847163) has the molecular formula C9H8F3N5 and a molecular weight of 243.19 g/mol. Its IUPAC name is (8S)-8-methyl-5-(trifluoromethyl)-3,4,6,9,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | (8S)-8-methyl-5-(trifluoromethyl)-3,4,6,9,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 156847163 |
| Molecular Formula | C9H8F3N5 |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (8S)-8-methyl-5-(trifluoromethyl)-3,4,6,9,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | C[C@H]1Cn2c(nnc2C(F)(F)F)-c2cncn21 |
| InChI | InChI=1S/C9H8F3N5/c1-5-3-16-7(6-2-13-4-17(5)6)14-15-8(16)9(10,11)12/h2,4-5H,3H2,1H3/t5-/m0/s1 |
| InChIKey | NNNRVEXWKIDDCV-YFKPBYRVSA-N |
| XLogP | 1.74 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |