About N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide
N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide (PubChem CID 156847397) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide.
Molecular Properties
| Compound Name | N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide |
| PubChem CID | 156847397 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide |
| SMILES | CON(C)C(=O)C1CCc2cc(C)ccc21 |
| InChI | InChI=1S/C13H17NO2/c1-9-4-6-11-10(8-9)5-7-12(11)13(15)14(2)16-3/h4,6,8,12H,5,7H2,1-3H3 |
| InChIKey | MJRWHKDQWNOQFK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide?
The IUPAC name of N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide (CID 156847397) is N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide.
What is the SMILES notation for N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide?
The canonical SMILES for N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide is CON(C)C(=O)C1CCc2cc(C)ccc21.
What is the InChIKey of N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide?
The InChIKey is MJRWHKDQWNOQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-9-4-6-11-10(8-9)5-7-12(11)13(15)14(2)16-3/h4,6,8,12H,5,7H2,1-3H3.
What are the key properties of N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide?
N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide has a molecular weight of 219.28 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N,5-dimethyl-2,3-dihydro-1H-indene-1-carboxamide is sourced from PubChem (CID 156847397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).