About ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate
ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 156848080) has the molecular formula C18H13ClFN3O4
and a molecular weight of 389.77 g/mol. Its IUPAC name is ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate |
| PubChem CID | 156848080 |
| Molecular Formula | C18H13ClFN3O4 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cnc3c(n2)COC3)c2cc(F)c(Cl)cc2c1=O |
| InChI | InChI=1S/C18H13ClFN3O4/c1-2-27-18(25)10-6-23(16-5-21-13-7-26-8-14(13)22-16)15-4-12(20)11(19)3-9(15)17(10)24/h3-6H,2,7-8H2,1H3 |
| InChIKey | PEPGDYNXMCWBLH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate?
The IUPAC name of ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate (CID 156848080) is ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate.
What is the SMILES notation for ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate?
The canonical SMILES for ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate is CCOC(=O)c1cn(-c2cnc3c(n2)COC3)c2cc(F)c(Cl)cc2c1=O.
What is the InChIKey of ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate?
The InChIKey is PEPGDYNXMCWBLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClFN3O4/c1-2-27-18(25)10-6-23(16-5-21-13-7-26-8-14(13)22-16)15-4-12(20)11(19)3-9(15)17(10)24/h3-6H,2,7-8H2,1H3.
What are the key properties of ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate?
ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate has a molecular weight of 389.77 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-chloro-1-(5,7-dihydrofuro[3,4-b]pyrazin-3-yl)-7-fluoro-4-oxoquinoline-3-carboxylate is sourced from PubChem (CID 156848080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).