C12H15FN2O — CID 156848733
1-[(3-fluoro-2-pyridinyl)oxymethyl]-7-azabicyclo[2.2.1]heptane (PubChem CID 156848733) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is 1-[(3-fluoro-2-pyridinyl)oxymethyl]-7-azabicyclo[2.2.1]heptane.
| Compound Name | 1-[(3-fluoro-2-pyridinyl)oxymethyl]-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 156848733 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-[(3-fluoro-2-pyridinyl)oxymethyl]-7-azabicyclo[2.2.1]heptane |
| SMILES | Fc1cccnc1OCC12CCC(CC1)N2 |
| InChI | InChI=1S/C12H15FN2O/c13-10-2-1-7-14-11(10)16-8-12-5-3-9(15-12)4-6-12/h1-2,7,9,15H,3-6,8H2 |
| InChIKey | UHEWGPDQLOOVKB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |