C23H32O7 — CID 156848862
7-(1-hydroxypropan-2-yl)-1,9-dimethyl-8-propan-2-yloxy-3,6,10,15-tetraoxahexacyclo[10.7.0.02,4.02,9.05,7.013,17]nonadec-13(17)-en-16-one (PubChem CID 156848862) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is 7-(1-hydroxypropan-2-yl)-1,9-dimethyl-8-propan-2-yloxy-3,6,10,15-tetraoxahexacyclo[10.7.0.02,4.02,9.05,7.013,17]nonadec-13(17)-en-16-one.
| Compound Name | 7-(1-hydroxypropan-2-yl)-1,9-dimethyl-8-propan-2-yloxy-3,6,10,15-tetraoxahexacyclo[10.7.0.02,4.02,9.05,7.013,17]nonadec-13(17)-en-16-one |
|---|---|
| PubChem CID | 156848862 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 7-(1-hydroxypropan-2-yl)-1,9-dimethyl-8-propan-2-yloxy-3,6,10,15-tetraoxahexacyclo[10.7.0.02,4.02,9.05,7.013,17]nonadec-13(17)-en-16-one |
| SMILES | CC(C)OC1C2(C(C)CO)OC2C2OC23C2(C)CCC4=C(COC4=O)C2COC13C |
| InChI | InChI=1S/C23H32O7/c1-11(2)28-19-21(5)23(17(30-23)16-22(19,29-16)12(3)8-24)20(4)7-6-13-14(9-26-18(13)25)15(20)10-27-21/h11-12,15-17,19,24H,6-10H2,1-5H3 |
| InChIKey | OKULPXUUDGINBL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|