C26H32O9 — CID 156848903
2,2-dimethyl-4-[[(1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl]oxy]-4-oxobutanoic acid (PubChem CID 156848903) has the molecular formula C26H32O9 and a molecular weight of 488.53 g/mol. Its IUPAC name is 2,2-dimethyl-4-[[(1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 2,2-dimethyl-4-[[(1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 156848903 |
| Molecular Formula | C26H32O9 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 2,2-dimethyl-4-[[(1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl]oxy]-4-oxobutanoic acid |
| SMILES | CC(C)[C@]12O[C@H]1[C@@H]1O[C@]13[C@]1(O[C@H]1C[C@H]1C4=C(CC[C@@]13C)C(=O)OC4)[C@@H]2OC(=O)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C26H32O9/c1-11(2)24-17(34-24)18-26(35-18)23(5)7-6-12-13(10-31-19(12)28)14(23)8-15-25(26,33-15)20(24)32-16(27)9-22(3,4)21(29)30/h11,14-15,17-18,20H,6-10H2,1-5H3,(H,29,30)/t14-,15-,17-,18-,20+,23-,24-,25+,26+/m0/s1 |
| InChIKey | JMNBOEFYUFWRJZ-RSXRJJQOSA-N |
| XLogP | 2.15 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|