About CID 156849290
CID 156849290 (PubChem CID 156849290) has the molecular formula C25H23F3N5O2S2Se
and a molecular weight of 625.58 g/mol.
Molecular Properties
| Compound Name | CID 156849290 |
| PubChem CID | 156849290 |
| Molecular Formula | C25H23F3N5O2S2Se |
| Molecular Weight | 625.58 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | — |
| SMILES | C=N/C(=N\C=C/C)c1ccc(-c2nc(Nc3ncc(C(F)(F)F)cc3C(=O)OC)sc2C2CC2)cc1.S[Se] |
| InChI | InChI=1S/C25H22F3N5O2S.HSSe/c1-4-11-30-21(29-2)16-9-5-14(6-10-16)19-20(15-7-8-15)36-24(32-19)33-22-18(23(34)35-3)12-17(13-31-22)25(26,27)28;1-2/h4-6,9-13,15H,2,7-8H2,1,3H3,(H,31,32,33);1H/b11-4-,30-21-; |
| InChIKey | LCALGZJZRVEPJO-JJODLHSDSA-N |
| XLogP | 6.61 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 625.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 156849290 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156849290?
The IUPAC name of CID 156849290 (CID 156849290) is not available.
What is the SMILES notation for CID 156849290?
The canonical SMILES for CID 156849290 is C=N/C(=N\C=C/C)c1ccc(-c2nc(Nc3ncc(C(F)(F)F)cc3C(=O)OC)sc2C2CC2)cc1.S[Se].
What is the InChIKey of CID 156849290?
The InChIKey is LCALGZJZRVEPJO-JJODLHSDSA-N. The full InChI is InChI=1S/C25H22F3N5O2S.HSSe/c1-4-11-30-21(29-2)16-9-5-14(6-10-16)19-20(15-7-8-15)36-24(32-19)33-22-18(23(34)35-3)12-17(13-31-22)25(26,27)28;1-2/h4-6,9-13,15H,2,7-8H2,1,3H3,(H,31,32,33);1H/b11-4-,30-21-;.
What are the key properties of CID 156849290?
CID 156849290 has a molecular weight of 625.58 g/mol, XLogP of 6.61, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156849290 is sourced from PubChem (CID 156849290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).