C16H19BrO2 — CID 156849566
2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione (PubChem CID 156849566) has the molecular formula C16H19BrO2 and a molecular weight of 323.23 g/mol. Its IUPAC name is 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione.
| Compound Name | 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 156849566 |
| Molecular Formula | C16H19BrO2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione |
| SMILES | O=C1CC(CCCCCCBr)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H19BrO2/c17-10-6-2-1-3-7-12-11-15(18)13-8-4-5-9-14(13)16(12)19/h4-5,8-9,12H,1-3,6-7,10-11H2 |
| InChIKey | RDPIXOCOLMISQH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|