About 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione
2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione (PubChem CID 156849566) has the molecular formula C16H19BrO2
and a molecular weight of 323.23 g/mol. Its IUPAC name is 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione |
| PubChem CID | 156849566 |
| Molecular Formula | C16H19BrO2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione |
| SMILES | O=C1CC(CCCCCCBr)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H19BrO2/c17-10-6-2-1-3-7-12-11-15(18)13-8-4-5-9-14(13)16(12)19/h4-5,8-9,12H,1-3,6-7,10-11H2 |
| InChIKey | RDPIXOCOLMISQH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione?
The IUPAC name of 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione (CID 156849566) is 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione.
What is the SMILES notation for 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione?
The canonical SMILES for 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione is O=C1CC(CCCCCCBr)C(=O)c2ccccc21.
What is the InChIKey of 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione?
The InChIKey is RDPIXOCOLMISQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrO2/c17-10-6-2-1-3-7-12-11-15(18)13-8-4-5-9-14(13)16(12)19/h4-5,8-9,12H,1-3,6-7,10-11H2.
What are the key properties of 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione?
2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione has a molecular weight of 323.23 g/mol, XLogP of 4.42, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromohexyl)-2,3-dihydronaphthalene-1,4-dione is sourced from PubChem (CID 156849566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).