About 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid
2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid (PubChem CID 156849580) has the molecular formula C20H16BrCl2NO2S
and a molecular weight of 485.23 g/mol. Its IUPAC name is 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid |
| PubChem CID | 156849580 |
| Molecular Formula | C20H16BrCl2NO2S |
| Molecular Weight | 485.23 g/mol |
| Exact Mass | 482.95 |
| IUPAC Name | 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid |
| SMILES | CC(C)Cc1sc(-c2ccc(Br)c(C(=O)O)c2)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16BrCl2NO2S/c1-10(2)7-17-18(11-4-6-15(22)16(23)9-11)24-19(27-17)12-3-5-14(21)13(8-12)20(25)26/h3-6,8-10H,7H2,1-2H3,(H,25,26) |
| InChIKey | JAKXYKXKYVHPSA-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.23 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid?
The IUPAC name of 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid (CID 156849580) is 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid.
What is the SMILES notation for 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid?
The canonical SMILES for 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid is CC(C)Cc1sc(-c2ccc(Br)c(C(=O)O)c2)nc1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid?
The InChIKey is JAKXYKXKYVHPSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16BrCl2NO2S/c1-10(2)7-17-18(11-4-6-15(22)16(23)9-11)24-19(27-17)12-3-5-14(21)13(8-12)20(25)26/h3-6,8-10H,7H2,1-2H3,(H,25,26).
What are the key properties of 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid?
2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid has a molecular weight of 485.23 g/mol, XLogP of 7.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]benzoic acid is sourced from PubChem (CID 156849580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).