C8H7NOS — CID 156849646
4,5-dihydro-1,3-benzothiazole-2-carbaldehyde (PubChem CID 156849646) has the molecular formula C8H7NOS and a molecular weight of 165.22 g/mol. Its IUPAC name is 4,5-dihydro-1,3-benzothiazole-2-carbaldehyde.
| Compound Name | 4,5-dihydro-1,3-benzothiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 156849646 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 4,5-dihydro-1,3-benzothiazole-2-carbaldehyde |
| SMILES | O=Cc1nc2c(s1)C=CCC2 |
| InChI | InChI=1S/C8H7NOS/c10-5-8-9-6-3-1-2-4-7(6)11-8/h2,4-5H,1,3H2 |
| InChIKey | DSEHUKDSEALPFG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|