C21H20Cl2N2O3S — CID 156849851
2-benzyl-3-[[4-(3,4-dichlorophenyl)-5-formyl-1,3-thiazol-2-yl]amino]propanoic acid;methane (PubChem CID 156849851) has the molecular formula C21H20Cl2N2O3S and a molecular weight of 451.38 g/mol. Its IUPAC name is 2-benzyl-3-[[4-(3,4-dichlorophenyl)-5-formyl-1,3-thiazol-2-yl]amino]propanoic acid;methane.
| Compound Name | 2-benzyl-3-[[4-(3,4-dichlorophenyl)-5-formyl-1,3-thiazol-2-yl]amino]propanoic acid;methane |
|---|---|
| PubChem CID | 156849851 |
| Molecular Formula | C21H20Cl2N2O3S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-benzyl-3-[[4-(3,4-dichlorophenyl)-5-formyl-1,3-thiazol-2-yl]amino]propanoic acid;methane |
| SMILES | C.O=Cc1sc(NCC(Cc2ccccc2)C(=O)O)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N2O3S.CH4/c21-15-7-6-13(9-16(15)22)18-17(11-25)28-20(24-18)23-10-14(19(26)27)8-12-4-2-1-3-5-12;/h1-7,9,11,14H,8,10H2,(H,23,24)(H,26,27);1H4 |
| InChIKey | NBENCCHXULKKCZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|