C20H16N4O2 — CID 156850725
3-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenoxy]-2,3-dihydro-1H-indene-4-carbonitrile (PubChem CID 156850725) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenoxy]-2,3-dihydro-1H-indene-4-carbonitrile.
| Compound Name | 3-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenoxy]-2,3-dihydro-1H-indene-4-carbonitrile |
|---|---|
| PubChem CID | 156850725 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenoxy]-2,3-dihydro-1H-indene-4-carbonitrile |
| SMILES | [H]/N=C(\c1cnco1)c1cc(OC2CCc3cccc(C#N)c32)ccc1N |
| InChI | InChI=1S/C20H16N4O2/c21-9-13-3-1-2-12-4-7-17(19(12)13)26-14-5-6-16(22)15(8-14)20(23)18-10-24-11-25-18/h1-3,5-6,8,10-11,17,23H,4,7,22H2/b23-20- |
| InChIKey | JACBFKUSJGKDCA-ATJXCDBQSA-N |
| XLogP | 3.61 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|