C18H20N4 — CID 156850812
2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine (PubChem CID 156850812) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine.
| Compound Name | 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 156850812 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine |
| SMILES | N#Cc1ccc2c(c1)CCC2.[H]/N=C(\C)c1cc(N)ccc1N |
| InChI | InChI=1S/C10H9N.C8H11N3/c11-7-8-4-5-9-2-1-3-10(9)6-8;1-5(9)7-4-6(10)2-3-8(7)11/h4-6H,1-3H2;2-4,9H,10-11H2,1H3/b;9-5+ |
| InChIKey | NCNNMSAVYJBCKZ-DTDKZNDQSA-N |
| XLogP | 3.29 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|