About 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine
2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine (PubChem CID 156850812) has the molecular formula C18H20N4
and a molecular weight of 292.39 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine |
| PubChem CID | 156850812 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine |
| SMILES | N#Cc1ccc2c(c1)CCC2.[H]/N=C(\C)c1cc(N)ccc1N |
| InChI | InChI=1S/C10H9N.C8H11N3/c11-7-8-4-5-9-2-1-3-10(9)6-8;1-5(9)7-4-6(10)2-3-8(7)11/h4-6H,1-3H2;2-4,9H,10-11H2,1H3/b;9-5+ |
| InChIKey | NCNNMSAVYJBCKZ-DTDKZNDQSA-N |
| XLogP | 3.29 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine?
The IUPAC name of 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine (CID 156850812) is 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine.
What is the SMILES notation for 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine?
The canonical SMILES for 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine is N#Cc1ccc2c(c1)CCC2.[H]/N=C(\C)c1cc(N)ccc1N.
What is the InChIKey of 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine?
The InChIKey is NCNNMSAVYJBCKZ-DTDKZNDQSA-N. The full InChI is InChI=1S/C10H9N.C8H11N3/c11-7-8-4-5-9-2-1-3-10(9)6-8;1-5(9)7-4-6(10)2-3-8(7)11/h4-6H,1-3H2;2-4,9H,10-11H2,1H3/b;9-5+.
What are the key properties of 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine?
2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine has a molecular weight of 292.39 g/mol, XLogP of 3.29, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indene-5-carbonitrile;2-ethanimidoylbenzene-1,4-diamine is sourced from PubChem (CID 156850812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).