C18H15F3N4O — CID 156851030
8-[4-amino-3-(2,2,2-trifluoroethanimidoyl)phenoxy]-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 156851030) has the molecular formula C18H15F3N4O and a molecular weight of 360.34 g/mol. Its IUPAC name is 8-[4-amino-3-(2,2,2-trifluoroethanimidoyl)phenoxy]-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 8-[4-amino-3-(2,2,2-trifluoroethanimidoyl)phenoxy]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 156851030 |
| Molecular Formula | C18H15F3N4O |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 8-[4-amino-3-(2,2,2-trifluoroethanimidoyl)phenoxy]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | [H]/N=C(/c1cc(OC2CCCc3cc(C#N)cnc32)ccc1N)C(F)(F)F |
| InChI | InChI=1S/C18H15F3N4O/c19-18(20,21)17(24)13-7-12(4-5-14(13)23)26-15-3-1-2-11-6-10(8-22)9-25-16(11)15/h4-7,9,15,24H,1-3,23H2/b24-17- |
| InChIKey | FWLRLSMKDGKCQG-ULJHMMPZSA-N |
| XLogP | 3.92 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|