C10H12BrNO2 — CID 156851078
3-bromo-4-methoxy-5,6,7,8-tetrahydroquinolin-8-ol (PubChem CID 156851078) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is 3-bromo-4-methoxy-5,6,7,8-tetrahydroquinolin-8-ol.
| Compound Name | 3-bromo-4-methoxy-5,6,7,8-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 156851078 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 3-bromo-4-methoxy-5,6,7,8-tetrahydroquinolin-8-ol |
| SMILES | COc1c(Br)cnc2c1CCCC2O |
| InChI | InChI=1S/C10H12BrNO2/c1-14-10-6-3-2-4-8(13)9(6)12-5-7(10)11/h5,8,13H,2-4H2,1H3 |
| InChIKey | ZOCZZGJINLQXLX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |