C18H18N4O — CID 156851165
8-(4-amino-3-ethanimidoylphenoxy)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 156851165) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 8-(4-amino-3-ethanimidoylphenoxy)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 8-(4-amino-3-ethanimidoylphenoxy)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 156851165 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 8-(4-amino-3-ethanimidoylphenoxy)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | [H]/N=C(\C)c1cc(OC2CCCc3cc(C#N)cnc32)ccc1N |
| InChI | InChI=1S/C18H18N4O/c1-11(20)15-8-14(5-6-16(15)21)23-17-4-2-3-13-7-12(9-19)10-22-18(13)17/h5-8,10,17,20H,2-4,21H2,1H3/b20-11+ |
| InChIKey | UWZCCPMBUUXTMB-RGVLZGJSSA-N |
| XLogP | 3.38 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|