About 1,3-ditert-butylbenzene-5-ide;yttrium
1,3-ditert-butylbenzene-5-ide;yttrium (PubChem CID 156851219) has the molecular formula C14H21Y-
and a molecular weight of 278.23 g/mol. Its IUPAC name is 1,3-ditert-butylbenzene-5-ide;yttrium.
Molecular Properties
| Compound Name | 1,3-ditert-butylbenzene-5-ide;yttrium |
| PubChem CID | 156851219 |
| Molecular Formula | C14H21Y- |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1,3-ditert-butylbenzene-5-ide;yttrium |
| SMILES | CC(C)(C)c1c[c-]cc(C(C)(C)C)c1.[Y] |
| InChI | InChI=1S/C14H21.Y/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6;/h8-10H,1-6H3;/q-1; |
| InChIKey | NITNWXAGHCYYKI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,3-ditert-butylbenzene-5-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-ditert-butylbenzene-5-ide;yttrium?
The IUPAC name of 1,3-ditert-butylbenzene-5-ide;yttrium (CID 156851219) is 1,3-ditert-butylbenzene-5-ide;yttrium.
What is the SMILES notation for 1,3-ditert-butylbenzene-5-ide;yttrium?
The canonical SMILES for 1,3-ditert-butylbenzene-5-ide;yttrium is CC(C)(C)c1c[c-]cc(C(C)(C)C)c1.[Y].
What is the InChIKey of 1,3-ditert-butylbenzene-5-ide;yttrium?
The InChIKey is NITNWXAGHCYYKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21.Y/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6;/h8-10H,1-6H3;/q-1;.
What are the key properties of 1,3-ditert-butylbenzene-5-ide;yttrium?
1,3-ditert-butylbenzene-5-ide;yttrium has a molecular weight of 278.23 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-ditert-butylbenzene-5-ide;yttrium is sourced from PubChem (CID 156851219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).