About (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+)
(2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+) (PubChem CID 156851235) has the molecular formula C4H2NO3Rb
and a molecular weight of 197.53 g/mol. Its IUPAC name is (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+).
Molecular Properties
| Compound Name | (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+) |
| PubChem CID | 156851235 |
| Molecular Formula | C4H2NO3Rb |
| Molecular Weight | 197.53 g/mol |
| Exact Mass | 196.92 |
| IUPAC Name | (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+) |
| SMILES | [NH-]c1c(O)c(=O)c1=O.[Rb+] |
| InChI | InChI=1S/C4H3NO3.Rb/c5-1-2(6)4(8)3(1)7;/h(H3,5,6,7,8);/q;+1/p-1 |
| InChIKey | PDSKXGWHQVJPGF-UHFFFAOYSA-M |
| XLogP | -3.32 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.53 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+)?
The IUPAC name of (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+) (CID 156851235) is (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+).
What is the SMILES notation for (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+)?
The canonical SMILES for (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+) is [NH-]c1c(O)c(=O)c1=O.[Rb+].
What is the InChIKey of (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+)?
The InChIKey is PDSKXGWHQVJPGF-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H3NO3.Rb/c5-1-2(6)4(8)3(1)7;/h(H3,5,6,7,8);/q;+1/p-1.
What are the key properties of (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+)?
(2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+) has a molecular weight of 197.53 g/mol, XLogP of -3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-3,4-dioxocyclobuten-1-yl)azanide;rubidium(1+) is sourced from PubChem (CID 156851235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).