C34H34F6N2O6S — CID 156851815
tert-butyl 4-[(3,5-dicyclopropylphenyl)methyl-[2-[fluoro-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-ethoxybenzoate (PubChem CID 156851815) has the molecular formula C34H34F6N2O6S and a molecular weight of 712.71 g/mol. Its IUPAC name is tert-butyl 4-[(3,5-dicyclopropylphenyl)methyl-[2-[fluoro-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-ethoxybenzoate.
| Compound Name | tert-butyl 4-[(3,5-dicyclopropylphenyl)methyl-[2-[fluoro-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-ethoxybenzoate |
|---|---|
| PubChem CID | 156851815 |
| Molecular Formula | C34H34F6N2O6S |
| Molecular Weight | 712.71 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | tert-butyl 4-[(3,5-dicyclopropylphenyl)methyl-[2-[fluoro-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-ethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OC(C)(C)C)ccc1N(Cc1cc(C2CC2)cc(C2CC2)c1)C(=O)CN(F)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C34H34F6N2O6S/c1-5-47-25-15-21(33(44)48-34(2,3)4)10-11-24(25)41(16-18-12-22(19-6-7-19)14-23(13-18)20-8-9-20)26(43)17-42(40)49(45,46)32-30(38)28(36)27(35)29(37)31(32)39/h10-15,19-20H,5-9,16-17H2,1-4H3 |
| InChIKey | COJGIFLQJYLSNZ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.71 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|