About N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine
N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine (PubChem CID 156852631) has the molecular formula C19H18N2
and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine.
Molecular Properties
| Compound Name | N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine |
| PubChem CID | 156852631 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine |
| SMILES | C=C/C(=C\N=C)c1cnc(C)c(/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C19H18N2/c1-4-17(13-20-3)19-12-18(15(2)21-14-19)11-10-16-8-6-5-7-9-16/h4-14H,1,3H2,2H3/b11-10+,17-13+ |
| InChIKey | PZLDTOAQHGHZFL-DWLYSLLYSA-N |
| XLogP | 4.79 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine?
The IUPAC name of N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine (CID 156852631) is N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine.
What is the SMILES notation for N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine?
The canonical SMILES for N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine is C=C/C(=C\N=C)c1cnc(C)c(/C=C/c2ccccc2)c1.
What is the InChIKey of N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine?
The InChIKey is PZLDTOAQHGHZFL-DWLYSLLYSA-N. The full InChI is InChI=1S/C19H18N2/c1-4-17(13-20-3)19-12-18(15(2)21-14-19)11-10-16-8-6-5-7-9-16/h4-14H,1,3H2,2H3/b11-10+,17-13+.
What are the key properties of N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine?
N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine has a molecular weight of 274.37 g/mol, XLogP of 4.79, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-2-[6-methyl-5-[(E)-2-phenylethenyl]-3-pyridinyl]buta-1,3-dienyl]methanimine is sourced from PubChem (CID 156852631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).