About 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one
2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one (PubChem CID 156853126) has the molecular formula C21H24O8
and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one |
| PubChem CID | 156853126 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one |
| SMILES | COCOc1ccc2c(c1)OC(c1cc(OCOC)ccc1OCOC)CC2=O |
| InChI | InChI=1S/C21H24O8/c1-23-11-26-14-5-7-19(28-13-25-3)17(8-14)21-10-18(22)16-6-4-15(27-12-24-2)9-20(16)29-21/h4-9,21H,10-13H2,1-3H3 |
| InChIKey | HBKANHGECJOXGG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one?
The IUPAC name of 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one (CID 156853126) is 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one is COCOc1ccc2c(c1)OC(c1cc(OCOC)ccc1OCOC)CC2=O.
What is the InChIKey of 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one?
The InChIKey is HBKANHGECJOXGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O8/c1-23-11-26-14-5-7-19(28-13-25-3)17(8-14)21-10-18(22)16-6-4-15(27-12-24-2)9-20(16)29-21/h4-9,21H,10-13H2,1-3H3.
What are the key properties of 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one?
2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one has a molecular weight of 404.42 g/mol, XLogP of 3.34, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,5-bis(methoxymethoxy)phenyl]-7-(methoxymethoxy)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 156853126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).