C9H18N2O — CID 156853272
6,6-dimethyl-4,5-dihydro-1H-1,4-diazepin-7-one;ethane (PubChem CID 156853272) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 6,6-dimethyl-4,5-dihydro-1H-1,4-diazepin-7-one;ethane.
| Compound Name | 6,6-dimethyl-4,5-dihydro-1H-1,4-diazepin-7-one;ethane |
|---|---|
| PubChem CID | 156853272 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 6,6-dimethyl-4,5-dihydro-1H-1,4-diazepin-7-one;ethane |
| SMILES | CC.CC1(C)CNC=CNC1=O |
| InChI | InChI=1S/C7H12N2O.C2H6/c1-7(2)5-8-3-4-9-6(7)10;1-2/h3-4,8H,5H2,1-2H3,(H,9,10);1-2H3 |
| InChIKey | LJBPLAHNXORCHW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |