C33H29FN8O4 — CID 156853628
N-benzyl-2-[[3-(6-fluoro-2-pyridinyl)-1,2-oxazol-5-yl]methyl]-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 156853628) has the molecular formula C33H29FN8O4 and a molecular weight of 620.65 g/mol. Its IUPAC name is N-benzyl-2-[[3-(6-fluoro-2-pyridinyl)-1,2-oxazol-5-yl]methyl]-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-benzyl-2-[[3-(6-fluoro-2-pyridinyl)-1,2-oxazol-5-yl]methyl]-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 156853628 |
| Molecular Formula | C33H29FN8O4 |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | N-benzyl-2-[[3-(6-fluoro-2-pyridinyl)-1,2-oxazol-5-yl]methyl]-4,7-dioxo-8-(quinolin-5-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | O=C1CN2C(=O)CN(Cc3cc(-c4cccc(F)n4)no3)N(C(=O)NCc3ccccc3)C2CN1Cc1cccc2ncccc12 |
| InChI | InChI=1S/C33H29FN8O4/c34-29-13-5-12-27(37-29)28-15-24(46-38-28)18-40-20-32(44)41-21-31(43)39(17-23-9-4-11-26-25(23)10-6-14-35-26)19-30(41)42(40)33(45)36-16-22-7-2-1-3-8-22/h1-15,30H,16-21H2,(H,36,45) |
| InChIKey | NIXYWTRYZDSAPA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|