C12H14F6OSi — CID 15685383
2,2,3,3,3-pentafluoro-1-(4-fluorophenyl)-1-trimethylsilylpropan-1-ol (PubChem CID 15685383) has the molecular formula C12H14F6OSi and a molecular weight of 316.32 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(4-fluorophenyl)-1-trimethylsilylpropan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(4-fluorophenyl)-1-trimethylsilylpropan-1-ol |
|---|---|
| PubChem CID | 15685383 |
| Molecular Formula | C12H14F6OSi |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(4-fluorophenyl)-1-trimethylsilylpropan-1-ol |
| SMILES | C[Si](C)(C)C(O)(c1ccc(F)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6OSi/c1-20(2,3)10(19,11(14,15)12(16,17)18)8-4-6-9(13)7-5-8/h4-7,19H,1-3H3 |
| InChIKey | MIOSZLMJAVFGHI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|