C26H24FN7O2 — CID 156855068
1-ethyl-N-(1-ethyl-1,2,4-triazol-3-yl)-5-fluoro-2-[hydroxy(diphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 156855068) has the molecular formula C26H24FN7O2 and a molecular weight of 485.52 g/mol. Its IUPAC name is 1-ethyl-N-(1-ethyl-1,2,4-triazol-3-yl)-5-fluoro-2-[hydroxy(diphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 1-ethyl-N-(1-ethyl-1,2,4-triazol-3-yl)-5-fluoro-2-[hydroxy(diphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 156855068 |
| Molecular Formula | C26H24FN7O2 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-ethyl-N-(1-ethyl-1,2,4-triazol-3-yl)-5-fluoro-2-[hydroxy(diphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CCn1cnc(NC(=O)c2cc3c(nc2F)nc(C(O)(c2ccccc2)c2ccccc2)n3CC)n1 |
| InChI | InChI=1S/C26H24FN7O2/c1-3-33-16-28-25(32-33)31-23(35)19-15-20-22(29-21(19)27)30-24(34(20)4-2)26(36,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16,36H,3-4H2,1-2H3,(H,31,32,35) |
| InChIKey | DLJHLXOUEWUTPO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|