C22H19N7O — CID 156855141
[1-ethyl-6-(2H-tetrazol-5-yl)imidazo[4,5-b]pyridin-2-yl]-diphenylmethanol (PubChem CID 156855141) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is [1-ethyl-6-(2H-tetrazol-5-yl)imidazo[4,5-b]pyridin-2-yl]-diphenylmethanol.
| Compound Name | [1-ethyl-6-(2H-tetrazol-5-yl)imidazo[4,5-b]pyridin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 156855141 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [1-ethyl-6-(2H-tetrazol-5-yl)imidazo[4,5-b]pyridin-2-yl]-diphenylmethanol |
| SMILES | CCn1c(C(O)(c2ccccc2)c2ccccc2)nc2ncc(-c3nn[nH]n3)cc21 |
| InChI | InChI=1S/C22H19N7O/c1-2-29-18-13-15(19-25-27-28-26-19)14-23-20(18)24-21(29)22(30,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-14,30H,2H2,1H3,(H,25,26,27,28) |
| InChIKey | JBUIMXHFOYEKCO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |