C19H16BrClFNO — CID 156855578
(2S)-2-[(2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]-1,2,3,6-tetrahydropyridine (PubChem CID 156855578) has the molecular formula C19H16BrClFNO and a molecular weight of 408.70 g/mol. Its IUPAC name is (2S)-2-[(2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]-1,2,3,6-tetrahydropyridine.
| Compound Name | (2S)-2-[(2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 156855578 |
| Molecular Formula | C19H16BrClFNO |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | (2S)-2-[(2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]-1,2,3,6-tetrahydropyridine |
| SMILES | Fc1cc2c(c(Br)c1Cl)C[C@](c1ccccc1)([C@@H]1CC=CCN1)O2 |
| InChI | InChI=1S/C19H16BrClFNO/c20-17-13-11-19(12-6-2-1-3-7-12,16-8-4-5-9-23-16)24-15(13)10-14(22)18(17)21/h1-7,10,16,23H,8-9,11H2/t16-,19-/m0/s1 |
| InChIKey | QFRRFCPYAXWRSG-LPHOPBHVSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|