About [[(E)-benzylideneamino]-phenylmethyl] formate;ethane
[[(E)-benzylideneamino]-phenylmethyl] formate;ethane (PubChem CID 156855625) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is [[(E)-benzylideneamino]-phenylmethyl] formate;ethane.
Molecular Properties
| Compound Name | [[(E)-benzylideneamino]-phenylmethyl] formate;ethane |
| PubChem CID | 156855625 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [[(E)-benzylideneamino]-phenylmethyl] formate;ethane |
| SMILES | CC.O=COC(/N=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13NO2.C2H6/c17-12-18-15(14-9-5-2-6-10-14)16-11-13-7-3-1-4-8-13;1-2/h1-12,15H;1-2H3/b16-11+; |
| InChIKey | BMGVJTGMBPYFTJ-YFMOEUEHSA-N |
| XLogP | 4.00 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [[(E)-benzylideneamino]-phenylmethyl] formate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(E)-benzylideneamino]-phenylmethyl] formate;ethane?
The IUPAC name of [[(E)-benzylideneamino]-phenylmethyl] formate;ethane (CID 156855625) is [[(E)-benzylideneamino]-phenylmethyl] formate;ethane.
What is the SMILES notation for [[(E)-benzylideneamino]-phenylmethyl] formate;ethane?
The canonical SMILES for [[(E)-benzylideneamino]-phenylmethyl] formate;ethane is CC.O=COC(/N=C/c1ccccc1)c1ccccc1.
What is the InChIKey of [[(E)-benzylideneamino]-phenylmethyl] formate;ethane?
The InChIKey is BMGVJTGMBPYFTJ-YFMOEUEHSA-N. The full InChI is InChI=1S/C15H13NO2.C2H6/c17-12-18-15(14-9-5-2-6-10-14)16-11-13-7-3-1-4-8-13;1-2/h1-12,15H;1-2H3/b16-11+;.
What are the key properties of [[(E)-benzylideneamino]-phenylmethyl] formate;ethane?
[[(E)-benzylideneamino]-phenylmethyl] formate;ethane has a molecular weight of 269.34 g/mol, XLogP of 4.00, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(E)-benzylideneamino]-phenylmethyl] formate;ethane is sourced from PubChem (CID 156855625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).