About N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine
N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine (PubChem CID 156856294) has the molecular formula C22H20ClFN2O
and a molecular weight of 382.87 g/mol. Its IUPAC name is N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine |
| PubChem CID | 156856294 |
| Molecular Formula | C22H20ClFN2O |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine |
| SMILES | NCCNc1cccc(F)c1-c1c(Cl)ccc2c1CC(c1ccccc1)O2 |
| InChI | InChI=1S/C22H20ClFN2O/c23-16-9-10-19-15(13-20(27-19)14-5-2-1-3-6-14)21(16)22-17(24)7-4-8-18(22)26-12-11-25/h1-10,20,26H,11-13,25H2 |
| InChIKey | SFMZYAWJFGUTOQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine?
The IUPAC name of N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine (CID 156856294) is N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine?
The canonical SMILES for N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine is NCCNc1cccc(F)c1-c1c(Cl)ccc2c1CC(c1ccccc1)O2.
What is the InChIKey of N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine?
The InChIKey is SFMZYAWJFGUTOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20ClFN2O/c23-16-9-10-19-15(13-20(27-19)14-5-2-1-3-6-14)21(16)22-17(24)7-4-8-18(22)26-12-11-25/h1-10,20,26H,11-13,25H2.
What are the key properties of N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine?
N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine has a molecular weight of 382.87 g/mol, XLogP of 5.19, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(5-chloro-2-phenyl-2,3-dihydro-1-benzofuran-4-yl)-3-fluorophenyl]ethane-1,2-diamine is sourced from PubChem (CID 156856294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).