C12H20O4 — CID 156856973
[(1R,6S)-6-(dimethoxymethyl)cyclohex-3-en-1-yl]methyl acetate (PubChem CID 156856973) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is [(1R,6S)-6-(dimethoxymethyl)cyclohex-3-en-1-yl]methyl acetate.
| Compound Name | [(1R,6S)-6-(dimethoxymethyl)cyclohex-3-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 156856973 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(1R,6S)-6-(dimethoxymethyl)cyclohex-3-en-1-yl]methyl acetate |
| SMILES | COC(OC)[C@H]1CC=CC[C@H]1COC(C)=O |
| InChI | InChI=1S/C12H20O4/c1-9(13)16-8-10-6-4-5-7-11(10)12(14-2)15-3/h4-5,10-12H,6-8H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | OHBOGSUHQFUTHS-QWRGUYRKSA-N |
| XLogP | 1.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|