About 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one
7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 156857378) has the molecular formula C24H21N3O3
and a molecular weight of 399.45 g/mol. Its IUPAC name is 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 156857378 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C1CCC(n2cc(-c3ccc(Oc4ccccc4)cc3)c3c(=O)[nH]cnc32)CC1 |
| InChI | InChI=1S/C24H21N3O3/c28-18-10-8-17(9-11-18)27-14-21(22-23(27)25-15-26-24(22)29)16-6-12-20(13-7-16)30-19-4-2-1-3-5-19/h1-7,12-15,17H,8-11H2,(H,25,26,29) |
| InChIKey | NQLMWQPHZZXFSE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one (CID 156857378) is 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one is O=C1CCC(n2cc(-c3ccc(Oc4ccccc4)cc3)c3c(=O)[nH]cnc32)CC1.
What is the InChIKey of 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is NQLMWQPHZZXFSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O3/c28-18-10-8-17(9-11-18)27-14-21(22-23(27)25-15-26-24(22)29)16-6-12-20(13-7-16)30-19-4-2-1-3-5-19/h1-7,12-15,17H,8-11H2,(H,25,26,29).
What are the key properties of 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one?
7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 399.45 g/mol, XLogP of 4.87, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-oxocyclohexyl)-5-(4-phenoxyphenyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 156857378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).