C24H30N3NaO3S — CID 156857510
sodium;formyl(3-oxa-8-azatricyclo[6.2.2.02,6]dodeca-2(6),4-dien-4-ylsulfinyl)azanide;N-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine (PubChem CID 156857510) has the molecular formula C24H30N3NaO3S and a molecular weight of 463.58 g/mol. Its IUPAC name is sodium;formyl(3-oxa-8-azatricyclo[6.2.2.02,6]dodeca-2(6),4-dien-4-ylsulfinyl)azanide;N-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine.
| Compound Name | sodium;formyl(3-oxa-8-azatricyclo[6.2.2.02,6]dodeca-2(6),4-dien-4-ylsulfinyl)azanide;N-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
|---|---|
| PubChem CID | 156857510 |
| Molecular Formula | C24H30N3NaO3S |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | sodium;formyl(3-oxa-8-azatricyclo[6.2.2.02,6]dodeca-2(6),4-dien-4-ylsulfinyl)azanide;N-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
| SMILES | CNc1c2c(cc3c1CCC3)CCC2.O=C[N-]S(=O)c1cc2c(o1)C1CCN(CC1)C2.[Na+] |
| InChI | InChI=1S/C13H17N.C11H14N2O3S.Na/c1-14-13-11-6-2-4-9(11)8-10-5-3-7-12(10)13;14-7-12-17(15)10-5-9-6-13-3-1-8(2-4-13)11(9)16-10;/h8,14H,2-7H2,1H3;5,7-8H,1-4,6H2,(H,12,14);/q;;+1/p-1 |
| InChIKey | JSCCMHCEXINIEA-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 76.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|