About 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene
7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene (PubChem CID 156857587) has the molecular formula C13H17F
and a molecular weight of 192.28 g/mol. Its IUPAC name is 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene |
| PubChem CID | 156857587 |
| Molecular Formula | C13H17F |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene |
| SMILES | Cc1c(C(C)C)cc(F)c2c1CCC2 |
| InChI | InChI=1S/C13H17F/c1-8(2)12-7-13(14)11-6-4-5-10(11)9(12)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | ANYCOKCCSXZHOI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene?
The IUPAC name of 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene (CID 156857587) is 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene.
What is the SMILES notation for 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene?
The canonical SMILES for 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene is Cc1c(C(C)C)cc(F)c2c1CCC2.
What is the InChIKey of 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene?
The InChIKey is ANYCOKCCSXZHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F/c1-8(2)12-7-13(14)11-6-4-5-10(11)9(12)3/h7-8H,4-6H2,1-3H3.
What are the key properties of 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene?
7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene has a molecular weight of 192.28 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-methyl-5-propan-2-yl-2,3-dihydro-1H-indene is sourced from PubChem (CID 156857587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).