C30H47ClN4O6 — CID 156857979
(3-chlorophenyl)methyl N-[(2S)-3-cyclohexyl-1-[[(2S)-1-[methoxy(methyl)amino]-5-[methyl(pentyl)amino]-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 156857979) has the molecular formula C30H47ClN4O6 and a molecular weight of 595.18 g/mol. Its IUPAC name is (3-chlorophenyl)methyl N-[(2S)-3-cyclohexyl-1-[[(2S)-1-[methoxy(methyl)amino]-5-[methyl(pentyl)amino]-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | (3-chlorophenyl)methyl N-[(2S)-3-cyclohexyl-1-[[(2S)-1-[methoxy(methyl)amino]-5-[methyl(pentyl)amino]-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 156857979 |
| Molecular Formula | C30H47ClN4O6 |
| Molecular Weight | 595.18 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | (3-chlorophenyl)methyl N-[(2S)-3-cyclohexyl-1-[[(2S)-1-[methoxy(methyl)amino]-5-[methyl(pentyl)amino]-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCN(C)C(=O)CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)OCc1cccc(Cl)c1)C(=O)N(C)OC |
| InChI | InChI=1S/C30H47ClN4O6/c1-5-6-10-18-34(2)27(36)17-16-25(29(38)35(3)40-4)32-28(37)26(20-22-12-8-7-9-13-22)33-30(39)41-21-23-14-11-15-24(31)19-23/h11,14-15,19,22,25-26H,5-10,12-13,16-18,20-21H2,1-4H3,(H,32,37)(H,33,39)/t25-,26-/m0/s1 |
| InChIKey | SFZTVEWGCGHHER-UIOOFZCWSA-N |
| XLogP | 4.84 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.18 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|