C20H14F5O6PS — CID 156858548
(2,3,4,5,6-pentafluorophenyl) 5-diethoxyphosphorylcarbonyl-1-benzothiophene-2-carboxylate (PubChem CID 156858548) has the molecular formula C20H14F5O6PS and a molecular weight of 508.36 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-diethoxyphosphorylcarbonyl-1-benzothiophene-2-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-diethoxyphosphorylcarbonyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 156858548 |
| Molecular Formula | C20H14F5O6PS |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-diethoxyphosphorylcarbonyl-1-benzothiophene-2-carboxylate |
| SMILES | CCOP(=O)(OCC)C(=O)c1ccc2sc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)cc2c1 |
| InChI | InChI=1S/C20H14F5O6PS/c1-3-29-32(28,30-4-2)20(27)9-5-6-11-10(7-9)8-12(33-11)19(26)31-18-16(24)14(22)13(21)15(23)17(18)25/h5-8H,3-4H2,1-2H3 |
| InChIKey | QLMOLBRPQDEQCY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|