C17H23N3O2 — CID 156858667
1-(4-methylazecin-3-yl)-1,3-diazinane-2,4-dione;propane (PubChem CID 156858667) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(4-methylazecin-3-yl)-1,3-diazinane-2,4-dione;propane.
| Compound Name | 1-(4-methylazecin-3-yl)-1,3-diazinane-2,4-dione;propane |
|---|---|
| PubChem CID | 156858667 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(4-methylazecin-3-yl)-1,3-diazinane-2,4-dione;propane |
| SMILES | CCC.Cc1ccccccncc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H15N3O2.C3H8/c1-11-6-4-2-3-5-8-15-10-12(11)17-9-7-13(18)16-14(17)19;1-3-2/h2-6,8,10H,7,9H2,1H3,(H,16,18,19);3H2,1-2H3/b3-2-,4-2+,5-3-,6-4+,8-5-,11-6-,12-10+,12-11+,15-8+,15-10+; |
| InChIKey | HKFSPMVWGFZOEO-RNEHNTOUSA-N |
| XLogP | 3.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |