C21H18F3NO3S — CID 156859372
(8R)-8-[(1S,2S,3R)-2,3-difluoro-1-hydroxy-7-methylsulfonyl-2,3-dihydro-1H-inden-4-yl]-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carbonitrile (PubChem CID 156859372) has the molecular formula C21H18F3NO3S and a molecular weight of 421.44 g/mol. Its IUPAC name is (8R)-8-[(1S,2S,3R)-2,3-difluoro-1-hydroxy-7-methylsulfonyl-2,3-dihydro-1H-inden-4-yl]-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carbonitrile.
| Compound Name | (8R)-8-[(1S,2S,3R)-2,3-difluoro-1-hydroxy-7-methylsulfonyl-2,3-dihydro-1H-inden-4-yl]-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 156859372 |
| Molecular Formula | C21H18F3NO3S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (8R)-8-[(1S,2S,3R)-2,3-difluoro-1-hydroxy-7-methylsulfonyl-2,3-dihydro-1H-inden-4-yl]-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carbonitrile |
| SMILES | CS(=O)(=O)c1ccc([C@H]2CCCc3cc(F)cc(C#N)c32)c2c1[C@H](O)[C@H](F)[C@@H]2F |
| InChI | InChI=1S/C21H18F3NO3S/c1-29(27,28)15-6-5-14(17-18(15)21(26)20(24)19(17)23)13-4-2-3-10-7-12(22)8-11(9-25)16(10)13/h5-8,13,19-21,26H,2-4H2,1H3/t13-,19-,20-,21+/m1/s1 |
| InChIKey | FIQWNBSGKGLBGG-JUDQEUQKSA-N |
| XLogP | 3.96 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |