About N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide
N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide (PubChem CID 156859999) has the molecular formula C24H24N4O4S
and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide.
Molecular Properties
| Compound Name | N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide |
| PubChem CID | 156859999 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3cnn(C)c3c2)cc1S(=O)(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C24H24N4O4S/c1-15-6-5-7-16(2)23(15)27-33(30,31)22-13-19(10-11-21(22)32-4)26-24(29)17-8-9-18-14-25-28(3)20(18)12-17/h5-14,27H,1-4H3,(H,26,29) |
| InChIKey | KLTQZRJRNIMBCV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide?
The IUPAC name of N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide (CID 156859999) is N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide.
What is the SMILES notation for N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide?
The canonical SMILES for N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide is COc1ccc(NC(=O)c2ccc3cnn(C)c3c2)cc1S(=O)(=O)Nc1c(C)cccc1C.
What is the InChIKey of N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide?
The InChIKey is KLTQZRJRNIMBCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O4S/c1-15-6-5-7-16(2)23(15)27-33(30,31)22-13-19(10-11-21(22)32-4)26-24(29)17-8-9-18-14-25-28(3)20(18)12-17/h5-14,27H,1-4H3,(H,26,29).
What are the key properties of N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide?
N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide has a molecular weight of 464.55 g/mol, XLogP of 4.25, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-1-methylindazole-6-carboxamide is sourced from PubChem (CID 156859999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).