About 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile
4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile (PubChem CID 156860300) has the molecular formula C18H11N5OS
and a molecular weight of 345.39 g/mol. Its IUPAC name is 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile |
| PubChem CID | 156860300 |
| Molecular Formula | C18H11N5OS |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c[nH]n(-c3ccc(-c4nccs4)cn3)c2=O)cc1 |
| InChI | InChI=1S/C18H11N5OS/c19-9-12-1-3-13(4-2-12)15-11-22-23(18(15)24)16-6-5-14(10-21-16)17-20-7-8-25-17/h1-8,10-11,22H |
| InChIKey | MLKRPKKMWCEUJE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile?
The IUPAC name of 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile (CID 156860300) is 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile.
What is the SMILES notation for 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile?
The canonical SMILES for 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile is N#Cc1ccc(-c2c[nH]n(-c3ccc(-c4nccs4)cn3)c2=O)cc1.
What is the InChIKey of 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile?
The InChIKey is MLKRPKKMWCEUJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N5OS/c19-9-12-1-3-13(4-2-12)15-11-22-23(18(15)24)16-6-5-14(10-21-16)17-20-7-8-25-17/h1-8,10-11,22H.
What are the key properties of 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile?
4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile has a molecular weight of 345.39 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-oxo-2-[5-(1,3-thiazol-2-yl)-2-pyridinyl]-1H-pyrazol-4-yl]benzonitrile is sourced from PubChem (CID 156860300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).