C16H22N6O2 — CID 156860561
1-[7-(5-aminopentylamino)imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 156860561) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[7-(5-aminopentylamino)imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[7-(5-aminopentylamino)imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 156860561 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[7-(5-aminopentylamino)imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | NCCCCCNc1ccn2c(N3CCC(=O)NC3=O)cnc2c1 |
| InChI | InChI=1S/C16H22N6O2/c17-6-2-1-3-7-18-12-4-8-21-13(10-12)19-11-15(21)22-9-5-14(23)20-16(22)24/h4,8,10-11,18H,1-3,5-7,9,17H2,(H,20,23,24) |
| InChIKey | INJGYVQKOXYGCN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|