C21H28N2O2 — CID 156861554
ethane;2-[4-(methylaminomethyl)phenyl]-1-benzofuran-7-carboxamide (PubChem CID 156861554) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is ethane;2-[4-(methylaminomethyl)phenyl]-1-benzofuran-7-carboxamide.
| Compound Name | ethane;2-[4-(methylaminomethyl)phenyl]-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 156861554 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | ethane;2-[4-(methylaminomethyl)phenyl]-1-benzofuran-7-carboxamide |
| SMILES | CC.CC.CNCc1ccc(-c2cc3cccc(C(N)=O)c3o2)cc1 |
| InChI | InChI=1S/C17H16N2O2.2C2H6/c1-19-10-11-5-7-12(8-6-11)15-9-13-3-2-4-14(17(18)20)16(13)21-15;2*1-2/h2-9,19H,10H2,1H3,(H2,18,20);2*1-2H3 |
| InChIKey | DFBABDIWTDSUHM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |