C21H15ClF2N4O — CID 156861575
5-(3-chloroanilino)-N-(2,2-difluoroethyl)benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 156861575) has the molecular formula C21H15ClF2N4O and a molecular weight of 412.83 g/mol. Its IUPAC name is 5-(3-chloroanilino)-N-(2,2-difluoroethyl)benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-(3-chloroanilino)-N-(2,2-difluoroethyl)benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 156861575 |
| Molecular Formula | C21H15ClF2N4O |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 5-(3-chloroanilino)-N-(2,2-difluoroethyl)benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | O=C(NCC(F)F)c1ccc2c(c1)nc(Nc1cccc(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C21H15ClF2N4O/c22-13-2-1-3-14(9-13)27-20-16-6-7-25-10-17(16)15-5-4-12(8-18(15)28-20)21(29)26-11-19(23)24/h1-10,19H,11H2,(H,26,29)(H,27,28) |
| InChIKey | VTHMSXDDVVUMIV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|