C22H16Cl3N3O2 — CID 156861585
3,3-dichloropropyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carboxylate (PubChem CID 156861585) has the molecular formula C22H16Cl3N3O2 and a molecular weight of 460.75 g/mol. Its IUPAC name is 3,3-dichloropropyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carboxylate.
| Compound Name | 3,3-dichloropropyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 156861585 |
| Molecular Formula | C22H16Cl3N3O2 |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 3,3-dichloropropyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carboxylate |
| SMILES | O=C(OCCC(Cl)Cl)c1ccc2c(c1)nc(Nc1cccc(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C22H16Cl3N3O2/c23-14-2-1-3-15(11-14)27-21-17-6-8-26-12-18(17)16-5-4-13(10-19(16)28-21)22(29)30-9-7-20(24)25/h1-6,8,10-12,20H,7,9H2,(H,27,28) |
| InChIKey | SRUUFJFTJFXNHZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|