C21H16ClN3O3 — CID 156861586
2-hydroxyethyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carboxylate (PubChem CID 156861586) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is 2-hydroxyethyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carboxylate.
| Compound Name | 2-hydroxyethyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 156861586 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-hydroxyethyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carboxylate |
| SMILES | O=C(OCCO)c1ccc2c(c1)nc(Nc1cccc(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C21H16ClN3O3/c22-14-2-1-3-15(11-14)24-20-17-6-7-23-12-18(17)16-5-4-13(10-19(16)25-20)21(27)28-9-8-26/h1-7,10-12,26H,8-9H2,(H,24,25) |
| InChIKey | OEZBNMVDJLSIKU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|