C22H25FN6O4 — CID 156861875
6-[5-[2-[(4-fluoro-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl)methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one (PubChem CID 156861875) has the molecular formula C22H25FN6O4 and a molecular weight of 456.48 g/mol. Its IUPAC name is 6-[5-[2-[(4-fluoro-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl)methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one.
| Compound Name | 6-[5-[2-[(4-fluoro-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl)methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 156861875 |
| Molecular Formula | C22H25FN6O4 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 6-[5-[2-[(4-fluoro-1,3-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl)methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one |
| SMILES | Cc1nc(C)c2c(c1F)CC(CNCCC1CN(c3cnc4c(n3)NC(=O)CO4)C(=O)O1)C2 |
| InChI | InChI=1S/C22H25FN6O4/c1-11-15-5-13(6-16(15)19(23)12(2)26-11)7-24-4-3-14-9-29(22(31)33-14)17-8-25-21-20(27-17)28-18(30)10-32-21/h8,13-14,24H,3-7,9-10H2,1-2H3,(H,27,28,30) |
| InChIKey | UUUWZYMJZMOZHT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|