About ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate
ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate (PubChem CID 156862452) has the molecular formula C12H14FNO2
and a molecular weight of 223.25 g/mol. Its IUPAC name is ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate |
| PubChem CID | 156862452 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)C1Cc2ncc(F)c(C)c2C1 |
| InChI | InChI=1S/C12H14FNO2/c1-3-16-12(15)8-4-9-7(2)10(13)6-14-11(9)5-8/h6,8H,3-5H2,1-2H3 |
| InChIKey | AXEZHSVMGZEJAT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate?
The IUPAC name of ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate (CID 156862452) is ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate.
What is the SMILES notation for ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate?
The canonical SMILES for ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate is CCOC(=O)C1Cc2ncc(F)c(C)c2C1.
What is the InChIKey of ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate?
The InChIKey is AXEZHSVMGZEJAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO2/c1-3-16-12(15)8-4-9-7(2)10(13)6-14-11(9)5-8/h6,8H,3-5H2,1-2H3.
What are the key properties of ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate?
ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate has a molecular weight of 223.25 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-fluoro-4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate is sourced from PubChem (CID 156862452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).